CAS 28583-62-2 is the registry number for N1-(4-Butyryl-3-hydroxyphenyl)acetamide, Tech. . Offered by: Thermo Scientific. Available pack sizes: 1g, 5g, 10g.
N-(4-butanoyl-3-hydroxyphenyl)acetamide (CAS 28583-62-2) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: N-(4-butanoyl-3-hydroxyphenyl)acetamide. InChIKey: RSBIKRQPSYDRFZ-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | N-(4-butanoyl-3-hydroxyphenyl)acetamide |
| InChIKey | RSBIKRQPSYDRFZ-UHFFFAOYSA-N |
| SMILES | CCCC(=O)C1=C(C=C(C=C1)NC(=O)C)O |
Computed by PubChem (NCBI)