Products 285979-79-5
CAS 285979-79-5 appears in our catalog under these names: Equilin-d4, Equilin-d4, >95% (HPLC), Equilin-2,4,16,16-d4, 98 atom % D, min 98% Chemical Purity. Offered by: Chemat Brand, Hubei YoungXin, TRC, CDN, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 0,05g.
(9S,13S,14S)-2,4,16,16-tetradeuterio-3-hydroxy-13-methyl-6,9,11,12,14,15-hexahydrocyclopenta[a]phenanthren-17-one (CAS 285979-79-5) is a chemical compound with the molecular formula C18H20O2 and a molecular weight of 272.4 g/mol. IUPAC name: (9S,13S,14S)-2,4,16,16-tetradeuterio-3-hydroxy-13-methyl-6,9,11,12,14,15-hexahydrocyclopenta[a]phenanthren-17-one. InChIKey: WKRLQDKEXYKHJB-DLIXUXMWSA-N.
| Molecular formula | C18H20O2 |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | (9S,13S,14S)-2,4,16,16-tetradeuterio-3-hydroxy-13-methyl-6,9,11,12,14,15-hexahydrocyclopenta[a]phenanthren-17-one |
| InChIKey | WKRLQDKEXYKHJB-DLIXUXMWSA-N |
| SMILES | [2H]C1=CC2=C(CC=C3[C@@H]2CC[C@]4([C@H]3CC(C4=O)([2H])[2H])C)C(=C1O)[2H] |
Computed by PubChem (NCBI)