Products 285986-89-2
CAS 285986-89-2 is the registry number for (3-Amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)(4-nitrophenyl)methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-(4-nitrophenyl)methanone (CAS 285986-89-2) is a chemical compound with the molecular formula C16H13N3O3S and a molecular weight of 327.4 g/mol. IUPAC name: (3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-(4-nitrophenyl)methanone. InChIKey: IGRIYQWWLPXGAP-UHFFFAOYSA-N.
| Molecular formula | C16H13N3O3S |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | (3-amino-4,6-dimethylthieno[2,3-b]pyridin-2-yl)-(4-nitrophenyl)methanone |
| InChIKey | IGRIYQWWLPXGAP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C(=C(S2)C(=O)C3=CC=C(C=C3)[N+](=O)[O-])N)C |
Computed by PubChem (NCBI)