Products 312915-05-2
CAS 312915-05-2 appears in our catalog under these names: N-(2-Methoxyphenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-amine, 95%, (2-Methoxy-phenyl)-[4-(4-nitro-phenyl)-thiazol-2-yl]-amine, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
N-(2-methoxyphenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-amine (CAS 312915-05-2) is a chemical compound with the molecular formula C16H13N3O3S and a molecular weight of 327.4 g/mol. IUPAC name: N-(2-methoxyphenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-amine. InChIKey: WQUCUHIAOIPUMX-UHFFFAOYSA-N.
| Molecular formula | C16H13N3O3S |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | N-(2-methoxyphenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-amine |
| InChIKey | WQUCUHIAOIPUMX-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1NC2=NC(=CS2)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)