CAS 937605-30-6 is the registry number for 4-((5-phenyl-4-thioxo-2,3,5-triazolinyl)methoxy)benzoic acid. Offered by: Biosynth. Available pack sizes: 250mg.
4-[(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methoxy]benzoic acid (CAS 937605-30-6) is a chemical compound with the molecular formula C16H13N3O3S and a molecular weight of 327.4 g/mol. IUPAC name: 4-[(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methoxy]benzoic acid. InChIKey: IQKUFWFXCICUBV-UHFFFAOYSA-N.
| Molecular formula | C16H13N3O3S |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 4-[(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methoxy]benzoic acid |
| InChIKey | IQKUFWFXCICUBV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=NNC2=S)COC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)