CAS 642948-82-1 is the registry number for N-(indolinylthioxomethyl)(4-nitrophenyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(2,3-dihydroindole-1-carbothioyl)-4-nitrobenzamide (CAS 642948-82-1) is a chemical compound with the molecular formula C16H13N3O3S and a molecular weight of 327.4 g/mol. IUPAC name: N-(2,3-dihydroindole-1-carbothioyl)-4-nitrobenzamide. InChIKey: OHJSWYXGZHREKK-UHFFFAOYSA-N.
| Molecular formula | C16H13N3O3S |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | N-(2,3-dihydroindole-1-carbothioyl)-4-nitrobenzamide |
| InChIKey | OHJSWYXGZHREKK-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)C(=S)NC(=O)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)