Products 28610-30-2
CAS 28610-30-2 appears in our catalog under these names: Isoanhydroicaritin, Isoanhydroicaritin, 99.69%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 1 mg.
3,5-dihydroxy-2-(4-hydroxyphenyl)-7-methoxy-8-(3-methylbut-2-enyl)chromen-4-one (CAS 28610-30-2) is a chemical compound with the molecular formula C21H20O6 and a molecular weight of 368.4 g/mol. IUPAC name: 3,5-dihydroxy-2-(4-hydroxyphenyl)-7-methoxy-8-(3-methylbut-2-enyl)chromen-4-one. InChIKey: RJANATGWWPNKAL-UHFFFAOYSA-N.
| Molecular formula | C21H20O6 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 3,5-dihydroxy-2-(4-hydroxyphenyl)-7-methoxy-8-(3-methylbut-2-enyl)chromen-4-one |
| InChIKey | RJANATGWWPNKAL-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C=C(C2=C1OC(=C(C2=O)O)C3=CC=C(C=C3)O)O)OC)C |
Computed by PubChem (NCBI)