CAS 2863623-82-7 is the registry number for tert-Butyl 3-oxospiro[indoline-2,3'-pyrrolidine]-1'-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-oxospiro[1H-indole-2,3'-pyrrolidine]-1'-carboxylate (CAS 2863623-82-7) is a chemical compound with the molecular formula C16H20N2O3 and a molecular weight of 288.34 g/mol. IUPAC name: tert-butyl 3-oxospiro[1H-indole-2,3'-pyrrolidine]-1'-carboxylate. InChIKey: AKUJFOZRBNCMKT-UHFFFAOYSA-N.
| Molecular formula | C16H20N2O3 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | tert-butyl 3-oxospiro[1H-indole-2,3'-pyrrolidine]-1'-carboxylate |
| InChIKey | AKUJFOZRBNCMKT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)C(=O)C3=CC=CC=C3N2 |
Computed by PubChem (NCBI)