CAS 84418-35-9 appears in our catalog under these names: N-Nitroso Propranolol, N-Nitrosopropranolol, >95% (HPLC), N-Nitrosopropranolol, N-NITROSO PROPRANOLOL SOLUTION, N-nitrosopropranolol, 97%, 97%. Offered by: Chemat Brand, TRC, Mikromol, Biosynth, Sigma-Aldrich. Available pack sizes: on request, 100mg, 10mg, 50mg, 25mg, 1ML, 250mg, 1g.
N-(2-hydroxy-3-naphthalen-1-yloxypropyl)-N-propan-2-ylnitrous amide (CAS 84418-35-9) is a chemical compound with the molecular formula C16H20N2O3 and a molecular weight of 288.34 g/mol. IUPAC name: N-(2-hydroxy-3-naphthalen-1-yloxypropyl)-N-propan-2-ylnitrous amide. InChIKey: TXYRHXNLIUKPMM-UHFFFAOYSA-N.
| Molecular formula | C16H20N2O3 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | N-(2-hydroxy-3-naphthalen-1-yloxypropyl)-N-propan-2-ylnitrous amide |
| InChIKey | TXYRHXNLIUKPMM-UHFFFAOYSA-N |
| SMILES | CC(C)N(CC(COC1=CC=CC2=CC=CC=C21)O)N=O |
Computed by PubChem (NCBI)