CAS 98516-74-6 appears in our catalog under these names: H-Ile-amc, 95%, H–Ile–AMC. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
(2S,3S)-2-amino-3-methyl-N-(4-methyl-2-oxochromen-7-yl)pentanamide (CAS 98516-74-6) is a chemical compound with the molecular formula C16H20N2O3 and a molecular weight of 288.34 g/mol. IUPAC name: (2S,3S)-2-amino-3-methyl-N-(4-methyl-2-oxochromen-7-yl)pentanamide. InChIKey: MLILEIUKVIPULY-VFZGTOFNSA-N.
| Molecular formula | C16H20N2O3 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | (2S,3S)-2-amino-3-methyl-N-(4-methyl-2-oxochromen-7-yl)pentanamide |
| InChIKey | MLILEIUKVIPULY-VFZGTOFNSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)NC1=CC2=C(C=C1)C(=CC(=O)O2)C)N |
Computed by PubChem (NCBI)