Products 727382-73-2

CAS 727382-73-2 is the registry number for 3-Dimethylaminomethylene-4-oxo-piperidine-1-carboxylic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Benzyl (3Z)-3-(dimethylaminomethylidene)-4-oxopiperidine-1-carboxylate (CAS 727382-73-2) is a chemical compound with the molecular formula C16H20N2O3 and a molecular weight of 288.34 g/mol. IUPAC name: benzyl (3Z)-3-(dimethylaminomethylidene)-4-oxopiperidine-1-carboxylate. InChIKey: XHGRPOTZWCEXPE-UVTDQMKNSA-N.

Identity
Molecular formulaC16H20N2O3
Molecular weight288.34 g/mol
IUPAC namebenzyl (3Z)-3-(dimethylaminomethylidene)-4-oxopiperidine-1-carboxylate
InChIKeyXHGRPOTZWCEXPE-UVTDQMKNSA-N
SMILESCN(C)/C=C\1/CN(CCC1=O)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)