CAS 2864476-73-1 is the registry number for 1,1-DIMETHYLETHYL 3-(4-METHYLBENZOYL)-3,8-DIAZABICYCLO[3.2.1]OCTANE-8-CARBOXYLATE, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-(4-methylbenzoyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (CAS 2864476-73-1) is a chemical compound with the molecular formula C19H26N2O3 and a molecular weight of 330.4 g/mol. IUPAC name: tert-butyl 3-(4-methylbenzoyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate. InChIKey: IISZCRAXSQZYKV-UHFFFAOYSA-N.
| Molecular formula | C19H26N2O3 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | tert-butyl 3-(4-methylbenzoyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | IISZCRAXSQZYKV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)N2CC3CCC(C2)N3C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)