CAS 28657-76-3 appears in our catalog under these names: Cinoxacin Impurity 2, (1,3)Dioxolo(4,5-g)cinnolin-4-ol. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 10g.
1H-[1,3]dioxolo[4,5-g]cinnolin-4-one (CAS 28657-76-3) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 1H-[1,3]dioxolo[4,5-g]cinnolin-4-one. InChIKey: JYLILOXPNNBOBA-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 1H-[1,3]dioxolo[4,5-g]cinnolin-4-one |
| InChIKey | JYLILOXPNNBOBA-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C3C(=C2)C(=O)C=NN3 |
Computed by PubChem (NCBI)