Products 2866315-43-5
CAS 2866315-43-5 is the registry number for tert-Butyl 6-oxo-5-azaspiro[3.4]octane-2-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 100mg, 250mg.
Tert-butyl 6-oxo-5-azaspiro[3.4]octane-2-carboxylate (CAS 2866315-43-5) is a chemical compound with the molecular formula C12H19NO3 and a molecular weight of 225.28 g/mol. IUPAC name: tert-butyl 6-oxo-5-azaspiro[3.4]octane-2-carboxylate. InChIKey: NGZHUGXRJOWJLA-UHFFFAOYSA-N.
| Molecular formula | C12H19NO3 |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | tert-butyl 6-oxo-5-azaspiro[3.4]octane-2-carboxylate |
| InChIKey | NGZHUGXRJOWJLA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CC2(C1)CCC(=O)N2 |
Computed by PubChem (NCBI)