CAS 28705-96-6 appears in our catalog under these names: 4-Hydroxychlorpropham, >95% (HPLC), Propan-2-yl N-(3-chloro-4-hydroxyphenyl)carbamate. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg, 0,5g.
Propan-2-yl N-(3-chloro-4-hydroxyphenyl)carbamate (CAS 28705-96-6) is a chemical compound with the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. IUPAC name: propan-2-yl N-(3-chloro-4-hydroxyphenyl)carbamate. InChIKey: LODWUFQKCTUNBU-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO3 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | propan-2-yl N-(3-chloro-4-hydroxyphenyl)carbamate |
| InChIKey | LODWUFQKCTUNBU-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)NC1=CC(=C(C=C1)O)Cl |
Computed by PubChem (NCBI)