Products 287116-76-1
CAS 287116-76-1 appears in our catalog under these names: 2-bromo-5-(2-methyl-1,3-dioxolan-2-yl)pyridine, ≥95%, ≥95%, 2-Bromo-5-(2-methyl-1,3-dioxolan-2-yl)pyridine, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
2-bromo-5-(2-methyl-1,3-dioxolan-2-yl)pyridine (CAS 287116-76-1) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: 2-bromo-5-(2-methyl-1,3-dioxolan-2-yl)pyridine. InChIKey: TWXWZKJIIXWMPS-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | 2-bromo-5-(2-methyl-1,3-dioxolan-2-yl)pyridine |
| InChIKey | TWXWZKJIIXWMPS-UHFFFAOYSA-N |
| SMILES | CC1(OCCO1)C2=CN=C(C=C2)Br |
Computed by PubChem (NCBI)