CAS 2874373-80-3 is the registry number for 5,6-Dichloro-2'-methylspiro[indoline-3,3'-pyrrolidin]-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-dichloro-2'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one (CAS 2874373-80-3) is a chemical compound with the molecular formula C12H12Cl2N2O and a molecular weight of 271.14 g/mol. IUPAC name: 5,6-dichloro-2'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one. InChIKey: SQJRMBKMDMQZMA-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl2N2O |
|---|---|
| Molecular weight | 271.14 g/mol |
| IUPAC name | 5,6-dichloro-2'-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one |
| InChIKey | SQJRMBKMDMQZMA-UHFFFAOYSA-N |
| SMILES | CC1C2(CCN1)C3=CC(=C(C=C3NC2=O)Cl)Cl |
Computed by PubChem (NCBI)