CAS 950037-38-4 is the registry number for 2-Chloro-N-(4-chloro-3-methylphenyl)-N-(2-cyanoethyl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-N-(4-chloro-3-methylphenyl)-N-(2-cyanoethyl)acetamide (CAS 950037-38-4) is a chemical compound with the molecular formula C12H12Cl2N2O and a molecular weight of 271.14 g/mol. IUPAC name: 2-chloro-N-(4-chloro-3-methylphenyl)-N-(2-cyanoethyl)acetamide. InChIKey: QSEAHGVSAVAQEV-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl2N2O |
|---|---|
| Molecular weight | 271.14 g/mol |
| IUPAC name | 2-chloro-N-(4-chloro-3-methylphenyl)-N-(2-cyanoethyl)acetamide |
| InChIKey | QSEAHGVSAVAQEV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N(CCC#N)C(=O)CCl)Cl |
Computed by PubChem (NCBI)