CAS 57432-78-7 appears in our catalog under these names: 1-(2, 4-Dichlorophenyl)-2-(2-Methylimidazole-1-yl)-Ethanol, Miconazole Impurity 5, 1-(2,4-dichlorophenyl)-2-(2-methyl-1H-imidazol-1-yl)ethanol. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,4-dichlorophenyl)-2-(2-methylimidazol-1-yl)ethanol (CAS 57432-78-7) is a chemical compound with the molecular formula C12H12Cl2N2O and a molecular weight of 271.14 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-2-(2-methylimidazol-1-yl)ethanol. InChIKey: BSLUBNLAHVXRAU-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl2N2O |
|---|---|
| Molecular weight | 271.14 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)-2-(2-methylimidazol-1-yl)ethanol |
| InChIKey | BSLUBNLAHVXRAU-UHFFFAOYSA-N |
| SMILES | CC1=NC=CN1CC(C2=C(C=C(C=C2)Cl)Cl)O |
Computed by PubChem (NCBI)