CAS 747408-78-2 appears in our catalog under these names: Pbt-1033, 95%, PBT-1033/ 98.12% (existing batch purity), PBT 1033, 5,7-Dichloro-2-[(dimethylamino)methyl]-8-quinolinol, 98%, 98%, PBT 1033, 99.51%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg.
5,7-dichloro-2-[(dimethylamino)methyl]quinolin-8-ol (CAS 747408-78-2) is a chemical compound with the molecular formula C12H12Cl2N2O and a molecular weight of 271.14 g/mol. IUPAC name: 5,7-dichloro-2-[(dimethylamino)methyl]quinolin-8-ol. InChIKey: YZPOQCQXOSEMAZ-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl2N2O |
|---|---|
| Molecular weight | 271.14 g/mol |
| IUPAC name | 5,7-dichloro-2-[(dimethylamino)methyl]quinolin-8-ol |
| InChIKey | YZPOQCQXOSEMAZ-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=NC2=C(C=C1)C(=CC(=C2O)Cl)Cl |
Computed by PubChem (NCBI)