CAS 3457-98-5 appears in our catalog under these names: 4–Aminoazobenzene Hydrochloride, 4-Aminoazobenzene Hydrochloride, >95.0%(HPLC), 4-(Phenyldiazenyl)aniline hydrochloride, 97%, 97%. Offered by: GLPBio, TCI, Chemat. Available pack sizes: 100g, 25g, 500g, 5g.
4-phenyldiazenylaniline;hydrochloride (CAS 3457-98-5) is a chemical compound with the molecular formula C12H12ClN3 and a molecular weight of 233.69 g/mol. IUPAC name: 4-phenyldiazenylaniline;hydrochloride. InChIKey: WMNTYZIRLUBHEE-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3 |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 4-phenyldiazenylaniline;hydrochloride |
| InChIKey | WMNTYZIRLUBHEE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)