CAS 2879-16-5 appears in our catalog under these names: 8-(hydroxymethyl)-1,3-dimethyl-1H-purine-2,6(3H,7H)-dione, 8-(hydroxymethyl)-1,3-dimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione, 98%, 98%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 0,5g.
8-(hydroxymethyl)-1,3-dimethyl-7H-purine-2,6-dione (CAS 2879-16-5) is a chemical compound with the molecular formula C8H10N4O3 and a molecular weight of 210.19 g/mol. IUPAC name: 8-(hydroxymethyl)-1,3-dimethyl-7H-purine-2,6-dione. InChIKey: GHYKZCOUOKEWNN-UHFFFAOYSA-N.
| Molecular formula | C8H10N4O3 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | 8-(hydroxymethyl)-1,3-dimethyl-7H-purine-2,6-dione |
| InChIKey | GHYKZCOUOKEWNN-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)NC(=N2)CO |
Computed by PubChem (NCBI)