Products 2879235-73-9
CAS 2879235-73-9 appears in our catalog under these names: 3-(4-Chloropyridin-2-yl)oxetan-3-amine (hydrochloride), 95.92%, 3-(4-Chloropyridin-2-yl)oxetan-3-amine hydrochloride, 95%, 3-(4-Chloropyridin-2-yl)oxetan-3-amine (hydrochloride), 95%. Offered by: MedChemExpress, Chemat, Fluorochem. Available pack sizes: 250 mg, 100 mg, 100mg, 250mg.
3-(4-chloro-2-pyridinyl)oxetan-3-amine;hydrochloride (CAS 2879235-73-9) is a chemical compound with the molecular formula C8H10Cl2N2O and a molecular weight of 221.08 g/mol. IUPAC name: 3-(4-chloro-2-pyridinyl)oxetan-3-amine;hydrochloride. InChIKey: XQDPCRIYQGQKLD-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2N2O |
|---|---|
| Molecular weight | 221.08 g/mol |
| IUPAC name | 3-(4-chloro-2-pyridinyl)oxetan-3-amine;hydrochloride |
| InChIKey | XQDPCRIYQGQKLD-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=NC=CC(=C2)Cl)N.Cl |
Computed by PubChem (NCBI)