CAS 287933-33-9 is the registry number for 3-Phenyl-1,4-benzodioxine-2-carbaldehyde. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-phenyl-1,4-benzodioxine-2-carbaldehyde (CAS 287933-33-9) is a chemical compound with the molecular formula C15H10O3 and a molecular weight of 238.24 g/mol. IUPAC name: 3-phenyl-1,4-benzodioxine-2-carbaldehyde. InChIKey: BQFFKKHQXOJXBD-UHFFFAOYSA-N.
| Molecular formula | C15H10O3 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 3-phenyl-1,4-benzodioxine-2-carbaldehyde |
| InChIKey | BQFFKKHQXOJXBD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(OC3=CC=CC=C3O2)C=O |
Computed by PubChem (NCBI)