CAS 2880-73-1 is the registry number for Lincomycin Impurity 2 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,4R)-4-ethyl-1-methylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 2880-73-1) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: (2S,4R)-4-ethyl-1-methylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: SLOHNCKVHLZACR-HHQFNNIRSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | (2S,4R)-4-ethyl-1-methylpyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | SLOHNCKVHLZACR-HHQFNNIRSA-N |
| SMILES | CC[C@@H]1C[C@H](N(C1)C)C(=O)O.Cl |
Computed by PubChem (NCBI)