Products 2880-73-1

CAS 2880-73-1 is the registry number for Lincomycin Impurity 2 HCl. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S,4R)-4-ethyl-1-methylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 2880-73-1) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: (2S,4R)-4-ethyl-1-methylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: SLOHNCKVHLZACR-HHQFNNIRSA-N.

Identity
Molecular formulaC8H16ClNO2
Molecular weight193.67 g/mol
IUPAC name(2S,4R)-4-ethyl-1-methylpyrrolidine-2-carboxylic acid;hydrochloride
InChIKeySLOHNCKVHLZACR-HHQFNNIRSA-N
SMILESCC[C@@H]1C[C@H](N(C1)C)C(=O)O.Cl

Computed by PubChem (NCBI)