Products 2883716-51-4
CAS 2883716-51-4 is the registry number for Antifungal agent 95. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2Z)-N-[2-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-2-(furan-2-yl)-2-hydroxyiminoacetamide (CAS 2883716-51-4) is a chemical compound with the molecular formula C17H17N3O4 and a molecular weight of 327.33 g/mol. IUPAC name: (2Z)-N-[2-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-2-(furan-2-yl)-2-hydroxyiminoacetamide. InChIKey: KNRYQYHAUHMQLW-SXHYEUBBSA-N.
| Molecular formula | C17H17N3O4 |
|---|---|
| Molecular weight | 327.33 g/mol |
| IUPAC name | (2Z)-N-[2-[(4R)-4-ethyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-2-(furan-2-yl)-2-hydroxyiminoacetamide |
| InChIKey | KNRYQYHAUHMQLW-SXHYEUBBSA-N |
| SMILES | CC[C@@H]1COC(=N1)C2=CC=CC=C2NC(=O)/C(=N\O)/C3=CC=CO3 |
Computed by PubChem (NCBI)
Synonyms:
Antifungal agent 95, orb2566994