CAS 28859-96-3 is the registry number for N,N,2,5-Tetramethylbenzenesulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
N,N,2,5-tetramethylbenzenesulfonamide (CAS 28859-96-3) is a chemical compound with the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. IUPAC name: N,N,2,5-tetramethylbenzenesulfonamide. InChIKey: LLGUBNPYANMOBH-UHFFFAOYSA-N.
| Molecular formula | C10H15NO2S |
|---|---|
| Molecular weight | 213.30 g/mol |
| IUPAC name | N,N,2,5-tetramethylbenzenesulfonamide |
| InChIKey | LLGUBNPYANMOBH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)N(C)C |
Computed by PubChem (NCBI)