CAS 288617-71-0 appears in our catalog under these names: (2S)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-2-methylpent-4-enoic acid, 95%, Fmoc-alpha-allyl-L-alanine, Fmoc–alpha–allyl–L–alanine, Fmoc-alpha-methyl-L-allylglycine, Fmoc-α-Me-L-Gly(allyl)-OH 97%. Offered by: Combi-blocks, TargetMol, GLPBio, Iris Biotech, Ambeed. Available pack sizes: 5g, 1g, 250mg, 2mg, 5mg, 10mg, 100mg, 10g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpent-4-enoic acid (CAS 288617-71-0) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpent-4-enoic acid. InChIKey: FNCSRFHDUZYOCR-NRFANRHFSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpent-4-enoic acid |
| InChIKey | FNCSRFHDUZYOCR-NRFANRHFSA-N |
| SMILES | C[C@](CC=C)(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)