CAS 288617-76-5 appears in our catalog under these names: Fmoc-alpha-allyl-d-ala, 95%, Fmoc–α–methyl–D–allylglycine, Fmoc-alpha-methyl-D-allylglycine, Fmoc-α-Me-D-Gly(Allyl)-OH 97%, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-methylpent-4-enoic acid, 99.52%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, MedChemExpress. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg, 250 mg, 1 g, 100 mg.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpent-4-enoic acid (CAS 288617-76-5) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpent-4-enoic acid. InChIKey: FNCSRFHDUZYOCR-OAQYLSRUSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpent-4-enoic acid |
| InChIKey | FNCSRFHDUZYOCR-OAQYLSRUSA-N |
| SMILES | C[C@@](CC=C)(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)