CAS 28865-97-6 is the registry number for Droxidopa Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3R)-2-amino-3-hydroxy-3-(4-hydroxy-3-methoxyphenyl)propanoic acid (CAS 28865-97-6) is a chemical compound with the molecular formula C10H13NO5 and a molecular weight of 227.21 g/mol. IUPAC name: (2S,3R)-2-amino-3-hydroxy-3-(4-hydroxy-3-methoxyphenyl)propanoic acid. InChIKey: WSTUOPKRORLDCX-DTWKUNHWSA-N.
| Molecular formula | C10H13NO5 |
|---|---|
| Molecular weight | 227.21 g/mol |
| IUPAC name | (2S,3R)-2-amino-3-hydroxy-3-(4-hydroxy-3-methoxyphenyl)propanoic acid |
| InChIKey | WSTUOPKRORLDCX-DTWKUNHWSA-N |
| SMILES | COC1=C(C=CC(=C1)[C@H]([C@@H](C(=O)O)N)O)O |
Computed by PubChem (NCBI)