Products 28865-97-6

CAS 28865-97-6 is the registry number for Droxidopa Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S,3R)-2-amino-3-hydroxy-3-(4-hydroxy-3-methoxyphenyl)propanoic acid (CAS 28865-97-6) is a chemical compound with the molecular formula C10H13NO5 and a molecular weight of 227.21 g/mol. IUPAC name: (2S,3R)-2-amino-3-hydroxy-3-(4-hydroxy-3-methoxyphenyl)propanoic acid. InChIKey: WSTUOPKRORLDCX-DTWKUNHWSA-N.

Identity
Molecular formulaC10H13NO5
Molecular weight227.21 g/mol
IUPAC name(2S,3R)-2-amino-3-hydroxy-3-(4-hydroxy-3-methoxyphenyl)propanoic acid
InChIKeyWSTUOPKRORLDCX-DTWKUNHWSA-N
SMILESCOC1=C(C=CC(=C1)[C@H]([C@@H](C(=O)O)N)O)O

Computed by PubChem (NCBI)