CAS 29025-01-2 appears in our catalog under these names: Droxidopa Impurity 7, (betaS)-rel-beta-Hydroxy-3-methoxy-D-tyrosine, Droxidopa Impurity 8-13C2-15N. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(2S,3R)-2-amino-3-hydroxy-3-(4-hydroxy-3-methoxyphenyl)propanoic acid (CAS 29025-01-2) is a chemical compound with the molecular formula C10H13NO5 and a molecular weight of 227.21 g/mol. IUPAC name: (2S,3R)-2-amino-3-hydroxy-3-(4-hydroxy-3-methoxyphenyl)propanoic acid. InChIKey: WSTUOPKRORLDCX-DTWKUNHWSA-N.
| Molecular formula | C10H13NO5 |
|---|---|
| Molecular weight | 227.21 g/mol |
| IUPAC name | (2S,3R)-2-amino-3-hydroxy-3-(4-hydroxy-3-methoxyphenyl)propanoic acid |
| InChIKey | WSTUOPKRORLDCX-DTWKUNHWSA-N |
| SMILES | COC1=C(C=CC(=C1)[C@H]([C@@H](C(=O)O)N)O)O |
Computed by PubChem (NCBI)