Products 2891598-04-0
CAS 2891598-04-0 is the registry number for 1-[(2,4-dimethoxyphenyl)methyl]-4-(1-hydroxy-1-methyl-ethyl)pyrrolidin-2-one, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-[(2,4-dimethoxyphenyl)methyl]-4-(2-hydroxypropan-2-yl)pyrrolidin-2-one (CAS 2891598-04-0) is a chemical compound with the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. IUPAC name: 1-[(2,4-dimethoxyphenyl)methyl]-4-(2-hydroxypropan-2-yl)pyrrolidin-2-one. InChIKey: SOMFXTAJMKJWCN-UHFFFAOYSA-N.
| Molecular formula | C16H23NO4 |
|---|---|
| Molecular weight | 293.36 g/mol |
| IUPAC name | 1-[(2,4-dimethoxyphenyl)methyl]-4-(2-hydroxypropan-2-yl)pyrrolidin-2-one |
| InChIKey | SOMFXTAJMKJWCN-UHFFFAOYSA-N |
| SMILES | CC(C)(C1CC(=O)N(C1)CC2=C(C=C(C=C2)OC)OC)O |
Computed by PubChem (NCBI)