Products 2891598-54-0
CAS 2891598-54-0 appears in our catalog under these names: Methyl 2-(azetidin-3-ylidene)acetate 4-methylbenzenesulfonate, 95%, methyl 2-(azetidin-3-ylidene)acetate,4-methylbenzenesulfonic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 25g, 5g, 1g.
Methyl 2-(azetidin-3-ylidene)acetate;4-methylbenzenesulfonic acid (CAS 2891598-54-0) is a chemical compound with the molecular formula C13H17NO5S and a molecular weight of 299.34 g/mol. IUPAC name: methyl 2-(azetidin-3-ylidene)acetate;4-methylbenzenesulfonic acid. InChIKey: IFJNWNXDFKANJO-UHFFFAOYSA-N.
| Molecular formula | C13H17NO5S |
|---|---|
| Molecular weight | 299.34 g/mol |
| IUPAC name | methyl 2-(azetidin-3-ylidene)acetate;4-methylbenzenesulfonic acid |
| InChIKey | IFJNWNXDFKANJO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.COC(=O)C=C1CNC1 |
Computed by PubChem (NCBI)