CAS 2891952-16-0 is the registry number for 2-(3,4-Dihydroquinolin-7-yl)propane-1,3-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,4-dihydroquinolin-7-yl)propane-1,3-diol (CAS 2891952-16-0) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 2-(3,4-dihydroquinolin-7-yl)propane-1,3-diol. InChIKey: OTZGKRZJNNRGFI-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 2-(3,4-dihydroquinolin-7-yl)propane-1,3-diol |
| InChIKey | OTZGKRZJNNRGFI-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)C(CO)CO)N=C1 |
Computed by PubChem (NCBI)