Products 2892449-70-4

CAS 2892449-70-4 is the registry number for 9-Imino-3-oxa-9l6-thiaspiro[5.5]undecane 9-oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-imino-9-oxa-3lambda6-thiaspiro[5.5]undecane 3-oxide (CAS 2892449-70-4) is a chemical compound with the molecular formula C9H17NO2S and a molecular weight of 203.30 g/mol. IUPAC name: 3-imino-9-oxa-3lambda6-thiaspiro[5.5]undecane 3-oxide. InChIKey: CQPOQTWJESVYFU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H17NO2S
Molecular weight203.30 g/mol
IUPAC name3-imino-9-oxa-3lambda6-thiaspiro[5.5]undecane 3-oxide
InChIKeyCQPOQTWJESVYFU-UHFFFAOYSA-N
SMILESC1COCCC12CCS(=N)(=O)CC2

Computed by PubChem (NCBI)