Products 2892730-36-6
CAS 2892730-36-6 is the registry number for 3-(6-(Aminomethyl)benzofuran-3-yl)piperidine-2,6-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[6-(aminomethyl)-1-benzofuran-3-yl]piperidine-2,6-dione (CAS 2892730-36-6) is a chemical compound with the molecular formula C14H14N2O3 and a molecular weight of 258.27 g/mol. IUPAC name: 3-[6-(aminomethyl)-1-benzofuran-3-yl]piperidine-2,6-dione. InChIKey: NWGGFBZTMAPHRT-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O3 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 3-[6-(aminomethyl)-1-benzofuran-3-yl]piperidine-2,6-dione |
| InChIKey | NWGGFBZTMAPHRT-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=COC3=C2C=CC(=C3)CN |
Computed by PubChem (NCBI)