CAS 2894007-97-5 is the registry number for 2,7,8-Trimethyl-4H-benzo[d][1,3]oxazin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,7,8-trimethyl-3,1-benzoxazin-4-one (CAS 2894007-97-5) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 2,7,8-trimethyl-3,1-benzoxazin-4-one. InChIKey: UQZYEMXBJJAHJP-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 2,7,8-trimethyl-3,1-benzoxazin-4-one |
| InChIKey | UQZYEMXBJJAHJP-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=O)OC(=N2)C)C |
Computed by PubChem (NCBI)