CAS 289483-83-6 appears in our catalog under these names: 4-Methyl-1H-indole-7-carboxylic acid, 98%, 4-Methyl-1H-indole-7-carboxylic acid, 4-Methyl-1h-indole-7-carboxylic acid, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 0,5g, 50mg, 100mg, 250mg, 500mg.
4-methyl-1H-indole-7-carboxylic acid (CAS 289483-83-6) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 4-methyl-1H-indole-7-carboxylic acid. InChIKey: QDZYFXYTLSGMMB-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 4-methyl-1H-indole-7-carboxylic acid |
| InChIKey | QDZYFXYTLSGMMB-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CNC2=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)