CAS 28954-19-0 is the registry number for Methyl 2,4-di-O-methyl-β-D-glucopyranoside. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg, 250mg.
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-3,5,6-trimethoxyoxan-4-ol (CAS 28954-19-0) is a chemical compound with the molecular formula C9H18O6 and a molecular weight of 222.24 g/mol. IUPAC name: (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-3,5,6-trimethoxyoxan-4-ol. InChIKey: GIHLORHCSSNTGS-ANZWQOBJSA-N.
| Molecular formula | C9H18O6 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-3,5,6-trimethoxyoxan-4-ol |
| InChIKey | GIHLORHCSSNTGS-ANZWQOBJSA-N |
| SMILES | CO[C@@H]1[C@H](O[C@H]([C@@H]([C@H]1O)OC)OC)CO |
Computed by PubChem (NCBI)