CAS 65877-27-2 is the registry number for 1,2,6-Tri-O-methyl-D-glucopyranoside. Offered by: Biosynth. Available pack sizes: 2g.
(2R,3S,4S,5R)-5,6-dimethoxy-2-(methoxymethyl)oxane-3,4-diol (CAS 65877-27-2) is a chemical compound with the molecular formula C9H18O6 and a molecular weight of 222.24 g/mol. IUPAC name: (2R,3S,4S,5R)-5,6-dimethoxy-2-(methoxymethyl)oxane-3,4-diol. InChIKey: FIORXPJOOANBBK-LOFWALOHSA-N.
| Molecular formula | C9H18O6 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | (2R,3S,4S,5R)-5,6-dimethoxy-2-(methoxymethyl)oxane-3,4-diol |
| InChIKey | FIORXPJOOANBBK-LOFWALOHSA-N |
| SMILES | COC[C@@H]1[C@H]([C@@H]([C@H](C(O1)OC)OC)O)O |
Computed by PubChem (NCBI)