CAS 34384-77-5 appears in our catalog under these names: Propylbeta-D-glucopyranoside, 98%, Propylbeta-D-glucopyranoside. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 5mg, 10mg, 25mg, 50mg.
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-propoxyoxane-3,4,5-triol (CAS 34384-77-5) is a chemical compound with the molecular formula C9H18O6 and a molecular weight of 222.24 g/mol. IUPAC name: (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-propoxyoxane-3,4,5-triol. InChIKey: ITOWTHYPYGRTRL-SYHAXYEDSA-N.
| Molecular formula | C9H18O6 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-propoxyoxane-3,4,5-triol |
| InChIKey | ITOWTHYPYGRTRL-SYHAXYEDSA-N |
| SMILES | CCCO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)