Products 4306-35-8

CAS 4306-35-8 is the registry number for 1,2-O-Isopropylidene-D-mannitol. Offered by: Biosynth, Chemat. Available pack sizes: 500mg, 250mg, 10g, 1g, 2g, 5g, 1000mg, 5000mg.

Structural formula: {0} (CAS {1})

(1S,2R,3R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butane-1,2,3,4-tetrol (CAS 4306-35-8) is a chemical compound with the molecular formula C9H18O6 and a molecular weight of 222.24 g/mol. IUPAC name: (1S,2R,3R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butane-1,2,3,4-tetrol. InChIKey: CWNIYRGNKYHYHW-WCTZXXKLSA-N.

Identity
Molecular formulaC9H18O6
Molecular weight222.24 g/mol
IUPAC name(1S,2R,3R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butane-1,2,3,4-tetrol
InChIKeyCWNIYRGNKYHYHW-WCTZXXKLSA-N
SMILESCC1(OC[C@@H](O1)[C@H]([C@@H]([C@@H](CO)O)O)O)C

Computed by PubChem (NCBI)