CAS 289635-85-4 appears in our catalog under these names: Methyl(2S)-2-Amino-3-(2-oxo-3-indolinyl)propanoateHydrochloride, 95%, 95%, Methyl (2S)-2-amino-3-(2-oxoindolin-3-yl)propanoate hydrochloride, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Methyl (2S)-2-amino-3-(2-oxo-1,3-dihydroindol-3-yl)propanoate;hydrochloride (CAS 289635-85-4) is a chemical compound with the molecular formula C12H15ClN2O3 and a molecular weight of 270.71 g/mol. IUPAC name: methyl (2S)-2-amino-3-(2-oxo-1,3-dihydroindol-3-yl)propanoate;hydrochloride. InChIKey: ZCEBNRCHWACIEK-MTFPJWTKSA-N.
| Molecular formula | C12H15ClN2O3 |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(2-oxo-1,3-dihydroindol-3-yl)propanoate;hydrochloride |
| InChIKey | ZCEBNRCHWACIEK-MTFPJWTKSA-N |
| SMILES | COC(=O)[C@H](CC1C2=CC=CC=C2NC1=O)N.Cl |
Computed by PubChem (NCBI)