CAS 289712-41-0 is the registry number for Ethyl 3-amino-5-phenylfuran-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 3-amino-5-phenylfuran-2-carboxylate (CAS 289712-41-0) is a chemical compound with the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. IUPAC name: ethyl 3-amino-5-phenylfuran-2-carboxylate. InChIKey: BDBLZEDTINOFHA-UHFFFAOYSA-N.
| Molecular formula | C13H13NO3 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | ethyl 3-amino-5-phenylfuran-2-carboxylate |
| InChIKey | BDBLZEDTINOFHA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(O1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)