Products 2897653-87-9
CAS 2897653-87-9 is the registry number for Monaspin B. Offered by: MedChemExpress. Available pack sizes: Get quote.
7a-methyl-3-methylidene-5-[(E)-4-oxopent-1-enyl]-3a,4,5,7-tetrahydro-1-benzofuran-2,6-dione (CAS 2897653-87-9) is a chemical compound with the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. IUPAC name: 7a-methyl-3-methylidene-5-[(E)-4-oxopent-1-enyl]-3a,4,5,7-tetrahydro-1-benzofuran-2,6-dione. InChIKey: UUHLKWWYEAWIAU-GQCTYLIASA-N.
| Molecular formula | C15H18O4 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | 7a-methyl-3-methylidene-5-[(E)-4-oxopent-1-enyl]-3a,4,5,7-tetrahydro-1-benzofuran-2,6-dione |
| InChIKey | UUHLKWWYEAWIAU-GQCTYLIASA-N |
| SMILES | CC(=O)C/C=C/C1CC2C(=C)C(=O)OC2(CC1=O)C |
Computed by PubChem (NCBI)
Synonyms:
Monaspin B