CAS 2901-80-6 appears in our catalog under these names: Benzoyl–DL–Valine, Benzoyl-DL-valine, >98.0%(T)(HPLC), Bz-DL-Val-OH 95%, 2-Benzamido-3-methylbutanoic acid, 95%, 95%, Benzoyl-DL-Valine, 99.91%. Offered by: GLPBio, TCI, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 500mg, 25g, 5g, 10g, 100g, 100 g, 500 g.
2-benzamido-3-methylbutanoic acid (CAS 2901-80-6) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: 2-benzamido-3-methylbutanoic acid. InChIKey: MIYQNOPLWKCHED-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 2-benzamido-3-methylbutanoic acid |
| InChIKey | MIYQNOPLWKCHED-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)NC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)