Products 5699-79-6
CAS 5699-79-6 appears in our catalog under these names: Bz-val-oh, 95%, Bz–Val–OH, Bz-Val-OH 98%, (S)-2-Benzamido-3-methylbutanoic acid, 98%, 98%, Benzoyl-L-Valine, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 25g, 1g.
(2S)-2-benzamido-3-methylbutanoic acid (CAS 5699-79-6) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: (2S)-2-benzamido-3-methylbutanoic acid. InChIKey: MIYQNOPLWKCHED-JTQLQIEISA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | (2S)-2-benzamido-3-methylbutanoic acid |
| InChIKey | MIYQNOPLWKCHED-JTQLQIEISA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)