Products 2901066-69-9
CAS 2901066-69-9 is the registry number for 1-Methyl 4-phenyl cubane-1,4-dicarboxylate, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-O-methyl 4-O-phenyl cubane-1,4-dicarboxylate (CAS 2901066-69-9) is a chemical compound with the molecular formula C17H14O4 and a molecular weight of 282.29 g/mol. IUPAC name: 1-O-methyl 4-O-phenyl cubane-1,4-dicarboxylate. InChIKey: KHQVGRYUQCWBEL-UHFFFAOYSA-N.
| Molecular formula | C17H14O4 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 1-O-methyl 4-O-phenyl cubane-1,4-dicarboxylate |
| InChIKey | KHQVGRYUQCWBEL-UHFFFAOYSA-N |
| SMILES | COC(=O)C12C3C4C1C5C2C3C45C(=O)OC6=CC=CC=C6 |
Computed by PubChem (NCBI)