Products 2901095-32-5
CAS 2901095-32-5 is the registry number for 4-Chloro-2-fluoro-3,5-dimethylbenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-chloro-2-fluoro-3,5-dimethylbenzoic acid (CAS 2901095-32-5) is a chemical compound with the molecular formula C9H8ClFO2 and a molecular weight of 202.61 g/mol. IUPAC name: 4-chloro-2-fluoro-3,5-dimethylbenzoic acid. InChIKey: BSKZBEIGLUULNJ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO2 |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | 4-chloro-2-fluoro-3,5-dimethylbenzoic acid |
| InChIKey | BSKZBEIGLUULNJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1Cl)C)F)C(=O)O |
Computed by PubChem (NCBI)