Products 2901102-15-4
CAS 2901102-15-4 is the registry number for 4-Bromo-2,3-dimethyl-1H-pyrrolo[2,3-b]pyridine, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 10g.
4-bromo-2,3-dimethyl-1H-pyrrolo[2,3-b]pyridine (CAS 2901102-15-4) is a chemical compound with the molecular formula C9H9BrN2 and a molecular weight of 225.08 g/mol. IUPAC name: 4-bromo-2,3-dimethyl-1H-pyrrolo[2,3-b]pyridine. InChIKey: NWSPLNZFJPHAMP-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2 |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 4-bromo-2,3-dimethyl-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | NWSPLNZFJPHAMP-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=NC=CC(=C12)Br)C |
Computed by PubChem (NCBI)